C16H15ClF3NO4S — CID 55681731
3-chloro-4-methoxy-N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide (PubChem CID 55681731) has the molecular formula C16H15ClF3NO4S and a molecular weight of 409.81 g/mol. Its IUPAC name is 3-chloro-4-methoxy-N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide.
| Compound Name | 3-chloro-4-methoxy-N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55681731 |
| Molecular Formula | C16H15ClF3NO4S |
| Molecular Weight | 409.81 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | 3-chloro-4-methoxy-N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)Cc2ccccc2OC(F)(F)F)cc1Cl |
| InChI | InChI=1S/C16H15ClF3NO4S/c1-21(10-11-5-3-4-6-14(11)25-16(18,19)20)26(22,23)12-7-8-15(24-2)13(17)9-12/h3-9H,10H2,1-2H3 |
| InChIKey | MIUFYONNPYVHIJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.81 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |