C15H20ClNO5 — CID 120703142
2-[3-(3-chloro-4-methoxyphenyl)propanoylamino]-4-methoxybutanoic acid (PubChem CID 120703142) has the molecular formula C15H20ClNO5 and a molecular weight of 329.78 g/mol. Its IUPAC name is 2-[3-(3-chloro-4-methoxyphenyl)propanoylamino]-4-methoxybutanoic acid.
| Compound Name | 2-[3-(3-chloro-4-methoxyphenyl)propanoylamino]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 120703142 |
| Molecular Formula | C15H20ClNO5 |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2-[3-(3-chloro-4-methoxyphenyl)propanoylamino]-4-methoxybutanoic acid |
| SMILES | COCCC(NC(=O)CCc1ccc(OC)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C15H20ClNO5/c1-21-8-7-12(15(19)20)17-14(18)6-4-10-3-5-13(22-2)11(16)9-10/h3,5,9,12H,4,6-8H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | WXSQSGPTAJEUKO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |