C10H8BrN5O2S — CID 41484180
3-amino-N'-(5-bromothiophene-2-carbonyl)pyrazine-2-carbohydrazide (PubChem CID 41484180) has the molecular formula C10H8BrN5O2S and a molecular weight of 342.18 g/mol. Its IUPAC name is 3-amino-N'-(5-bromothiophene-2-carbonyl)pyrazine-2-carbohydrazide.
| Compound Name | 3-amino-N'-(5-bromothiophene-2-carbonyl)pyrazine-2-carbohydrazide |
|---|---|
| PubChem CID | 41484180 |
| Molecular Formula | C10H8BrN5O2S |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 340.96 |
| IUPAC Name | 3-amino-N'-(5-bromothiophene-2-carbonyl)pyrazine-2-carbohydrazide |
| SMILES | Nc1nccnc1C(=O)NNC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C10H8BrN5O2S/c11-6-2-1-5(19-6)9(17)15-16-10(18)7-8(12)14-4-3-13-7/h1-4H,(H2,12,14)(H,15,17)(H,16,18) |
| InChIKey | OMFQWFKVZWXQAX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|