About 3-amino-N'-(3-methylbutanoyl)pyrazine-2-carbohydrazide
3-amino-N'-(3-methylbutanoyl)pyrazine-2-carbohydrazide (PubChem CID 30174136) has the molecular formula C10H15N5O2
and a molecular weight of 237.26 g/mol. Its IUPAC name is 3-amino-N'-(3-methylbutanoyl)pyrazine-2-carbohydrazide.
Molecular Properties
| Compound Name | 3-amino-N'-(3-methylbutanoyl)pyrazine-2-carbohydrazide |
| PubChem CID | 30174136 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 3-amino-N'-(3-methylbutanoyl)pyrazine-2-carbohydrazide |
| SMILES | CC(C)CC(=O)NNC(=O)c1nccnc1N |
| InChI | InChI=1S/C10H15N5O2/c1-6(2)5-7(16)14-15-10(17)8-9(11)13-4-3-12-8/h3-4,6H,5H2,1-2H3,(H2,11,13)(H,14,16)(H,15,17) |
| InChIKey | IHYVRAQQLUDSJO-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N'-(3-methylbutanoyl)pyrazine-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N'-(3-methylbutanoyl)pyrazine-2-carbohydrazide?
The IUPAC name of 3-amino-N'-(3-methylbutanoyl)pyrazine-2-carbohydrazide (CID 30174136) is 3-amino-N'-(3-methylbutanoyl)pyrazine-2-carbohydrazide.
What is the SMILES notation for 3-amino-N'-(3-methylbutanoyl)pyrazine-2-carbohydrazide?
The canonical SMILES for 3-amino-N'-(3-methylbutanoyl)pyrazine-2-carbohydrazide is CC(C)CC(=O)NNC(=O)c1nccnc1N.
What is the InChIKey of 3-amino-N'-(3-methylbutanoyl)pyrazine-2-carbohydrazide?
The InChIKey is IHYVRAQQLUDSJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5O2/c1-6(2)5-7(16)14-15-10(17)8-9(11)13-4-3-12-8/h3-4,6H,5H2,1-2H3,(H2,11,13)(H,14,16)(H,15,17).
What are the key properties of 3-amino-N'-(3-methylbutanoyl)pyrazine-2-carbohydrazide?
3-amino-N'-(3-methylbutanoyl)pyrazine-2-carbohydrazide has a molecular weight of 237.26 g/mol, XLogP of -0.13, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N'-(3-methylbutanoyl)pyrazine-2-carbohydrazide is sourced from PubChem (CID 30174136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).