C13H23N5O — CID 30480999
3-amino-N-[2-[di(propan-2-yl)amino]ethyl]pyrazine-2-carboxamide (PubChem CID 30480999) has the molecular formula C13H23N5O and a molecular weight of 265.36 g/mol. Its IUPAC name is 3-amino-N-[2-[di(propan-2-yl)amino]ethyl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[2-[di(propan-2-yl)amino]ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 30480999 |
| Molecular Formula | C13H23N5O |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 3-amino-N-[2-[di(propan-2-yl)amino]ethyl]pyrazine-2-carboxamide |
| SMILES | CC(C)N(CCNC(=O)c1nccnc1N)C(C)C |
| InChI | InChI=1S/C13H23N5O/c1-9(2)18(10(3)4)8-7-17-13(19)11-12(14)16-6-5-15-11/h5-6,9-10H,7-8H2,1-4H3,(H2,14,16)(H,17,19) |
| InChIKey | FTTAIKKKRXKBON-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |