C12H23N5 — CID 103633778
3-N-[2-[di(propan-2-yl)amino]ethyl]pyrazine-2,3-diamine (PubChem CID 103633778) has the molecular formula C12H23N5 and a molecular weight of 237.35 g/mol. Its IUPAC name is 3-N-[2-[di(propan-2-yl)amino]ethyl]pyrazine-2,3-diamine.
| Compound Name | 3-N-[2-[di(propan-2-yl)amino]ethyl]pyrazine-2,3-diamine |
|---|---|
| PubChem CID | 103633778 |
| Molecular Formula | C12H23N5 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.20 |
| IUPAC Name | 3-N-[2-[di(propan-2-yl)amino]ethyl]pyrazine-2,3-diamine |
| SMILES | CC(C)N(CCNc1nccnc1N)C(C)C |
| InChI | InChI=1S/C12H23N5/c1-9(2)17(10(3)4)8-7-16-12-11(13)14-5-6-15-12/h5-6,9-10H,7-8H2,1-4H3,(H2,13,14)(H,15,16) |
| InChIKey | RRHXHWZMGUACKA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |