C14H15N5O2 — CID 42003587
3-amino-N'-(4-ethylbenzoyl)pyrazine-2-carbohydrazide (PubChem CID 42003587) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 3-amino-N'-(4-ethylbenzoyl)pyrazine-2-carbohydrazide.
| Compound Name | 3-amino-N'-(4-ethylbenzoyl)pyrazine-2-carbohydrazide |
|---|---|
| PubChem CID | 42003587 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 3-amino-N'-(4-ethylbenzoyl)pyrazine-2-carbohydrazide |
| SMILES | CCc1ccc(C(=O)NNC(=O)c2nccnc2N)cc1 |
| InChI | InChI=1S/C14H15N5O2/c1-2-9-3-5-10(6-4-9)13(20)18-19-14(21)11-12(15)17-8-7-16-11/h3-8H,2H2,1H3,(H2,15,17)(H,18,20)(H,19,21) |
| InChIKey | ZONWCYVLTHRXMI-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|