About N-(5-bromo-1,3-thiazol-2-yl)-3-methyl-1,2-oxazole-5-carboxamide
N-(5-bromo-1,3-thiazol-2-yl)-3-methyl-1,2-oxazole-5-carboxamide (PubChem CID 60784496) has the molecular formula C8H6BrN3O2S
and a molecular weight of 288.13 g/mol. Its IUPAC name is N-(5-bromo-1,3-thiazol-2-yl)-3-methyl-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(5-bromo-1,3-thiazol-2-yl)-3-methyl-1,2-oxazole-5-carboxamide |
| PubChem CID | 60784496 |
| Molecular Formula | C8H6BrN3O2S |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 286.94 |
| IUPAC Name | N-(5-bromo-1,3-thiazol-2-yl)-3-methyl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ncc(Br)s2)on1 |
| InChI | InChI=1S/C8H6BrN3O2S/c1-4-2-5(14-12-4)7(13)11-8-10-3-6(9)15-8/h2-3H,1H3,(H,10,11,13) |
| InChIKey | CROQSYLQESBWGM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(5-bromo-1,3-thiazol-2-yl)-3-methyl-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromo-1,3-thiazol-2-yl)-3-methyl-1,2-oxazole-5-carboxamide?
The IUPAC name of N-(5-bromo-1,3-thiazol-2-yl)-3-methyl-1,2-oxazole-5-carboxamide (CID 60784496) is N-(5-bromo-1,3-thiazol-2-yl)-3-methyl-1,2-oxazole-5-carboxamide.
What is the SMILES notation for N-(5-bromo-1,3-thiazol-2-yl)-3-methyl-1,2-oxazole-5-carboxamide?
The canonical SMILES for N-(5-bromo-1,3-thiazol-2-yl)-3-methyl-1,2-oxazole-5-carboxamide is Cc1cc(C(=O)Nc2ncc(Br)s2)on1.
What is the InChIKey of N-(5-bromo-1,3-thiazol-2-yl)-3-methyl-1,2-oxazole-5-carboxamide?
The InChIKey is CROQSYLQESBWGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrN3O2S/c1-4-2-5(14-12-4)7(13)11-8-10-3-6(9)15-8/h2-3H,1H3,(H,10,11,13).
What are the key properties of N-(5-bromo-1,3-thiazol-2-yl)-3-methyl-1,2-oxazole-5-carboxamide?
N-(5-bromo-1,3-thiazol-2-yl)-3-methyl-1,2-oxazole-5-carboxamide has a molecular weight of 288.13 g/mol, XLogP of 2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromo-1,3-thiazol-2-yl)-3-methyl-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 60784496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).