C14H18BrN5O2 — CID 51290106
4-bromo-N'-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 51290106) has the molecular formula C14H18BrN5O2 and a molecular weight of 368.24 g/mol. Its IUPAC name is 4-bromo-N'-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 51290106 |
| Molecular Formula | C14H18BrN5O2 |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 4-bromo-N'-[3-(1,3,5-trimethylpyrazol-4-yl)propanoyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | Cc1nn(C)c(C)c1CCC(=O)NNC(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C14H18BrN5O2/c1-8-11(9(2)20(3)19-8)4-5-13(21)17-18-14(22)12-6-10(15)7-16-12/h6-7,16H,4-5H2,1-3H3,(H,17,21)(H,18,22) |
| InChIKey | ASSZJLIQCSJFDL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|