C14H14BrN3O2 — CID 31421337
4-bromo-N'-(2,3-dimethylbenzoyl)-1H-pyrrole-2-carbohydrazide (PubChem CID 31421337) has the molecular formula C14H14BrN3O2 and a molecular weight of 336.19 g/mol. Its IUPAC name is 4-bromo-N'-(2,3-dimethylbenzoyl)-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-(2,3-dimethylbenzoyl)-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 31421337 |
| Molecular Formula | C14H14BrN3O2 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 4-bromo-N'-(2,3-dimethylbenzoyl)-1H-pyrrole-2-carbohydrazide |
| SMILES | Cc1cccc(C(=O)NNC(=O)c2cc(Br)c[nH]2)c1C |
| InChI | InChI=1S/C14H14BrN3O2/c1-8-4-3-5-11(9(8)2)13(19)17-18-14(20)12-6-10(15)7-16-12/h3-7,16H,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | VKKJREIHYDKBRG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|