C17H18BrFN4O3 — CID 31598058
N-[(2S)-1-[2-(4-bromo-1H-pyrrole-2-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide (PubChem CID 31598058) has the molecular formula C17H18BrFN4O3 and a molecular weight of 425.26 g/mol. Its IUPAC name is N-[(2S)-1-[2-(4-bromo-1H-pyrrole-2-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide.
| Compound Name | N-[(2S)-1-[2-(4-bromo-1H-pyrrole-2-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 31598058 |
| Molecular Formula | C17H18BrFN4O3 |
| Molecular Weight | 425.26 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | N-[(2S)-1-[2-(4-bromo-1H-pyrrole-2-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccccc1F)C(=O)NNC(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C17H18BrFN4O3/c1-9(2)14(21-15(24)11-5-3-4-6-12(11)19)17(26)23-22-16(25)13-7-10(18)8-20-13/h3-9,14,20H,1-2H3,(H,21,24)(H,22,25)(H,23,26)/t14-/m0/s1 |
| InChIKey | KMLPFVRRYLVTSO-AWEZNQCLSA-N |
| XLogP | 2.13 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|