C22H26FN3O5 — CID 42910219
N-[1-[2-(4-ethoxy-3-methoxybenzoyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide (PubChem CID 42910219) has the molecular formula C22H26FN3O5 and a molecular weight of 431.46 g/mol. Its IUPAC name is N-[1-[2-(4-ethoxy-3-methoxybenzoyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide.
| Compound Name | N-[1-[2-(4-ethoxy-3-methoxybenzoyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 42910219 |
| Molecular Formula | C22H26FN3O5 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | N-[1-[2-(4-ethoxy-3-methoxybenzoyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)C(NC(=O)c2ccccc2F)C(C)C)cc1OC |
| InChI | InChI=1S/C22H26FN3O5/c1-5-31-17-11-10-14(12-18(17)30-4)20(27)25-26-22(29)19(13(2)3)24-21(28)15-8-6-7-9-16(15)23/h6-13,19H,5H2,1-4H3,(H,24,28)(H,25,27)(H,26,29) |
| InChIKey | GMKLSPLMNGTAFS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|