C22H28N4O5 — CID 46643345
1-[1-[2-(4-ethoxy-3-methoxybenzoyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3-phenylurea (PubChem CID 46643345) has the molecular formula C22H28N4O5 and a molecular weight of 428.49 g/mol. Its IUPAC name is 1-[1-[2-(4-ethoxy-3-methoxybenzoyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3-phenylurea.
| Compound Name | 1-[1-[2-(4-ethoxy-3-methoxybenzoyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3-phenylurea |
|---|---|
| PubChem CID | 46643345 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 1-[1-[2-(4-ethoxy-3-methoxybenzoyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3-phenylurea |
| SMILES | CCOc1ccc(C(=O)NNC(=O)C(NC(=O)Nc2ccccc2)C(C)C)cc1OC |
| InChI | InChI=1S/C22H28N4O5/c1-5-31-17-12-11-15(13-18(17)30-4)20(27)25-26-21(28)19(14(2)3)24-22(29)23-16-9-7-6-8-10-16/h6-14,19H,5H2,1-4H3,(H,25,27)(H,26,28)(H2,23,24,29) |
| InChIKey | BBXPXFDWPZZNOG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|