C23H29N3O7 — CID 35933812
N-[(2S)-1-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3,5-dimethoxybenzamide (PubChem CID 35933812) has the molecular formula C23H29N3O7 and a molecular weight of 459.50 g/mol. Its IUPAC name is N-[(2S)-1-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3,5-dimethoxybenzamide.
| Compound Name | N-[(2S)-1-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 35933812 |
| Molecular Formula | C23H29N3O7 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | N-[(2S)-1-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)N[C@H](C(=O)NNC(=O)c2ccc(OC)c(OC)c2)C(C)C)c1 |
| InChI | InChI=1S/C23H29N3O7/c1-13(2)20(24-21(27)15-9-16(30-3)12-17(10-15)31-4)23(29)26-25-22(28)14-7-8-18(32-5)19(11-14)33-6/h7-13,20H,1-6H3,(H,24,27)(H,25,28)(H,26,29)/t20-/m0/s1 |
| InChIKey | RZSMIGLZFXPNSN-FQEVSTJZSA-N |
| XLogP | 1.94 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|