C27H30N2O4 — CID 2464302
N-[(2S)-1-(benzhydrylamino)-3-methyl-1-oxobutan-2-yl]-3,5-dimethoxybenzamide (PubChem CID 2464302) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-[(2S)-1-(benzhydrylamino)-3-methyl-1-oxobutan-2-yl]-3,5-dimethoxybenzamide.
| Compound Name | N-[(2S)-1-(benzhydrylamino)-3-methyl-1-oxobutan-2-yl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 2464302 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | N-[(2S)-1-(benzhydrylamino)-3-methyl-1-oxobutan-2-yl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)N[C@H](C(=O)NC(c2ccccc2)c2ccccc2)C(C)C)c1 |
| InChI | InChI=1S/C27H30N2O4/c1-18(2)24(28-26(30)21-15-22(32-3)17-23(16-21)33-4)27(31)29-25(19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-18,24-25H,1-4H3,(H,28,30)(H,29,31)/t24-/m0/s1 |
| InChIKey | JKTDCSCSCLSTHY-DEOSSOPVSA-N |
| XLogP | 4.36 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |