C13H11BrFN3O3 — CID 31116513
4-bromo-N'-(5-fluoro-2-methoxybenzoyl)-1H-pyrrole-2-carbohydrazide (PubChem CID 31116513) has the molecular formula C13H11BrFN3O3 and a molecular weight of 356.15 g/mol. Its IUPAC name is 4-bromo-N'-(5-fluoro-2-methoxybenzoyl)-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-(5-fluoro-2-methoxybenzoyl)-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 31116513 |
| Molecular Formula | C13H11BrFN3O3 |
| Molecular Weight | 356.15 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | 4-bromo-N'-(5-fluoro-2-methoxybenzoyl)-1H-pyrrole-2-carbohydrazide |
| SMILES | COc1ccc(F)cc1C(=O)NNC(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C13H11BrFN3O3/c1-21-11-3-2-8(15)5-9(11)12(19)17-18-13(20)10-4-7(14)6-16-10/h2-6,16H,1H3,(H,17,19)(H,18,20) |
| InChIKey | YSHIFZYDRJMCHT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.15 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|