C14H14BrN3O4 — CID 17421548
4-bromo-N'-(2,4-dimethoxybenzoyl)-1H-pyrrole-2-carbohydrazide (PubChem CID 17421548) has the molecular formula C14H14BrN3O4 and a molecular weight of 368.19 g/mol. Its IUPAC name is 4-bromo-N'-(2,4-dimethoxybenzoyl)-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-(2,4-dimethoxybenzoyl)-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 17421548 |
| Molecular Formula | C14H14BrN3O4 |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 4-bromo-N'-(2,4-dimethoxybenzoyl)-1H-pyrrole-2-carbohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)c2cc(Br)c[nH]2)c(OC)c1 |
| InChI | InChI=1S/C14H14BrN3O4/c1-21-9-3-4-10(12(6-9)22-2)13(19)17-18-14(20)11-5-8(15)7-16-11/h3-7,16H,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | ZPVCYRZYGCFMCA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|