C24H31N3O4 — CID 26713846
4-butoxy-N-[2-oxo-2-[[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]ethyl]benzamide (PubChem CID 26713846) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is 4-butoxy-N-[2-oxo-2-[[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]ethyl]benzamide.
| Compound Name | 4-butoxy-N-[2-oxo-2-[[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 26713846 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 4-butoxy-N-[2-oxo-2-[[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]ethyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCC(=O)NCC(=O)Nc2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C24H31N3O4/c1-5-6-11-31-20-9-7-19(8-10-20)24(30)26-14-21(28)25-15-22(29)27-23-17(3)12-16(2)13-18(23)4/h7-10,12-13H,5-6,11,14-15H2,1-4H3,(H,25,28)(H,26,30)(H,27,29) |
| InChIKey | UHVFCROZWCFKKU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|