C14H17N3O5S2 — CID 68803331
4-(2-phenoxyethylamino)benzene-1,3-disulfonamide (PubChem CID 68803331) has the molecular formula C14H17N3O5S2 and a molecular weight of 371.44 g/mol. Its IUPAC name is 4-(2-phenoxyethylamino)benzene-1,3-disulfonamide.
| Compound Name | 4-(2-phenoxyethylamino)benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 68803331 |
| Molecular Formula | C14H17N3O5S2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 4-(2-phenoxyethylamino)benzene-1,3-disulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NCCOc2ccccc2)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C14H17N3O5S2/c15-23(18,19)12-6-7-13(14(10-12)24(16,20)21)17-8-9-22-11-4-2-1-3-5-11/h1-7,10,17H,8-9H2,(H2,15,18,19)(H2,16,20,21) |
| InChIKey | HRJXKMMVGRRQRY-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 141.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|