C15H13Cl2FN2O4 — CID 133340770
1-(2,6-dichlorophenyl)-2-(3-fluoro-5-methoxy-2-nitroanilino)ethanol (PubChem CID 133340770) has the molecular formula C15H13Cl2FN2O4 and a molecular weight of 375.18 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-2-(3-fluoro-5-methoxy-2-nitroanilino)ethanol.
| Compound Name | 1-(2,6-dichlorophenyl)-2-(3-fluoro-5-methoxy-2-nitroanilino)ethanol |
|---|---|
| PubChem CID | 133340770 |
| Molecular Formula | C15H13Cl2FN2O4 |
| Molecular Weight | 375.18 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-2-(3-fluoro-5-methoxy-2-nitroanilino)ethanol |
| SMILES | COc1cc(F)c([N+](=O)[O-])c(NCC(O)c2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C15H13Cl2FN2O4/c1-24-8-5-11(18)15(20(22)23)12(6-8)19-7-13(21)14-9(16)3-2-4-10(14)17/h2-6,13,19,21H,7H2,1H3 |
| InChIKey | ZKMRFKKEPVRDAG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.18 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|