C13H20FN3O3 — CID 133425148
1-N-(3-fluoro-5-methoxy-2-nitrophenyl)-2-N,2-N,2-trimethylpropane-1,2-diamine (PubChem CID 133425148) has the molecular formula C13H20FN3O3 and a molecular weight of 285.32 g/mol. Its IUPAC name is 1-N-(3-fluoro-5-methoxy-2-nitrophenyl)-2-N,2-N,2-trimethylpropane-1,2-diamine.
| Compound Name | 1-N-(3-fluoro-5-methoxy-2-nitrophenyl)-2-N,2-N,2-trimethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 133425148 |
| Molecular Formula | C13H20FN3O3 |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 1-N-(3-fluoro-5-methoxy-2-nitrophenyl)-2-N,2-N,2-trimethylpropane-1,2-diamine |
| SMILES | COc1cc(F)c([N+](=O)[O-])c(NCC(C)(C)N(C)C)c1 |
| InChI | InChI=1S/C13H20FN3O3/c1-13(2,16(3)4)8-15-11-7-9(20-5)6-10(14)12(11)17(18)19/h6-7,15H,8H2,1-5H3 |
| InChIKey | HMLQBCJCOCGGEJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|