C15H21N3O7 — CID 89263675
4-[1-(2,4-dinitroanilino)propan-2-yloxy]-2,2-dimethylbutanoic acid (PubChem CID 89263675) has the molecular formula C15H21N3O7 and a molecular weight of 355.35 g/mol. Its IUPAC name is 4-[1-(2,4-dinitroanilino)propan-2-yloxy]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[1-(2,4-dinitroanilino)propan-2-yloxy]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 89263675 |
| Molecular Formula | C15H21N3O7 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 4-[1-(2,4-dinitroanilino)propan-2-yloxy]-2,2-dimethylbutanoic acid |
| SMILES | CC(CNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])OCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C15H21N3O7/c1-10(25-7-6-15(2,3)14(19)20)9-16-12-5-4-11(17(21)22)8-13(12)18(23)24/h4-5,8,10,16H,6-7,9H2,1-3H3,(H,19,20) |
| InChIKey | FGOWHDOMDVZWTM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 144.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|