C14H15N5 — CID 64530668
2-methyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]quinolin-4-amine (PubChem CID 64530668) has the molecular formula C14H15N5 and a molecular weight of 253.31 g/mol. Its IUPAC name is 2-methyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]quinolin-4-amine.
| Compound Name | 2-methyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]quinolin-4-amine |
|---|---|
| PubChem CID | 64530668 |
| Molecular Formula | C14H15N5 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2-methyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]quinolin-4-amine |
| SMILES | Cc1cc(NCCc2ncn[nH]2)c2ccccc2n1 |
| InChI | InChI=1S/C14H15N5/c1-10-8-13(11-4-2-3-5-12(11)18-10)15-7-6-14-16-9-17-19-14/h2-5,8-9H,6-7H2,1H3,(H,15,18)(H,16,17,19) |
| InChIKey | JYALXVXEXMLMFW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |