C13H11BrClFN2 — CID 114835604
3-bromo-5-chloro-N-[2-(4-fluorophenyl)ethyl]pyridin-2-amine (PubChem CID 114835604) has the molecular formula C13H11BrClFN2 and a molecular weight of 329.60 g/mol. Its IUPAC name is 3-bromo-5-chloro-N-[2-(4-fluorophenyl)ethyl]pyridin-2-amine.
| Compound Name | 3-bromo-5-chloro-N-[2-(4-fluorophenyl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 114835604 |
| Molecular Formula | C13H11BrClFN2 |
| Molecular Weight | 329.60 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | 3-bromo-5-chloro-N-[2-(4-fluorophenyl)ethyl]pyridin-2-amine |
| SMILES | Fc1ccc(CCNc2ncc(Cl)cc2Br)cc1 |
| InChI | InChI=1S/C13H11BrClFN2/c14-12-7-10(15)8-18-13(12)17-6-5-9-1-3-11(16)4-2-9/h1-4,7-8H,5-6H2,(H,17,18) |
| InChIKey | OXQKYMDLONIZCJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |