C8H11ClN2O2 — CID 65314143
2-[(5-chloro-2-pyridinyl)amino]propane-1,3-diol (PubChem CID 65314143) has the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. Its IUPAC name is 2-[(5-chloro-2-pyridinyl)amino]propane-1,3-diol.
| Compound Name | 2-[(5-chloro-2-pyridinyl)amino]propane-1,3-diol |
|---|---|
| PubChem CID | 65314143 |
| Molecular Formula | C8H11ClN2O2 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 2-[(5-chloro-2-pyridinyl)amino]propane-1,3-diol |
| SMILES | OCC(CO)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C8H11ClN2O2/c9-6-1-2-8(10-3-6)11-7(4-12)5-13/h1-3,7,12-13H,4-5H2,(H,10,11) |
| InChIKey | BDGJIBQUUDBNOO-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |