C11H17ClN2O — CID 61246447
2-[(5-chloro-2-pyridinyl)amino]-4-methylpentan-1-ol (PubChem CID 61246447) has the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. Its IUPAC name is 2-[(5-chloro-2-pyridinyl)amino]-4-methylpentan-1-ol.
| Compound Name | 2-[(5-chloro-2-pyridinyl)amino]-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 61246447 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-[(5-chloro-2-pyridinyl)amino]-4-methylpentan-1-ol |
| SMILES | CC(C)CC(CO)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C11H17ClN2O/c1-8(2)5-10(7-15)14-11-4-3-9(12)6-13-11/h3-4,6,8,10,15H,5,7H2,1-2H3,(H,13,14) |
| InChIKey | XHHIOSTYTIOSKQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |