C12H19ClN2O — CID 115468697
2-(2-amino-5-chloroanilino)-4-methylpentan-1-ol (PubChem CID 115468697) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is 2-(2-amino-5-chloroanilino)-4-methylpentan-1-ol.
| Compound Name | 2-(2-amino-5-chloroanilino)-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 115468697 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-(2-amino-5-chloroanilino)-4-methylpentan-1-ol |
| SMILES | CC(C)CC(CO)Nc1cc(Cl)ccc1N |
| InChI | InChI=1S/C12H19ClN2O/c1-8(2)5-10(7-16)15-12-6-9(13)3-4-11(12)14/h3-4,6,8,10,15-16H,5,7,14H2,1-2H3 |
| InChIKey | OUDRHQOXMBZIGA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|