C13H22ClN3 — CID 113315727
4-chloro-2-N-[1-(diethylamino)propan-2-yl]benzene-1,2-diamine (PubChem CID 113315727) has the molecular formula C13H22ClN3 and a molecular weight of 255.79 g/mol. Its IUPAC name is 4-chloro-2-N-[1-(diethylamino)propan-2-yl]benzene-1,2-diamine.
| Compound Name | 4-chloro-2-N-[1-(diethylamino)propan-2-yl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 113315727 |
| Molecular Formula | C13H22ClN3 |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 4-chloro-2-N-[1-(diethylamino)propan-2-yl]benzene-1,2-diamine |
| SMILES | CCN(CC)CC(C)Nc1cc(Cl)ccc1N |
| InChI | InChI=1S/C13H22ClN3/c1-4-17(5-2)9-10(3)16-13-8-11(14)6-7-12(13)15/h6-8,10,16H,4-5,9,15H2,1-3H3 |
| InChIKey | RQYHZYKODWRCCC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|