C9H11ClF2N2 — CID 130639953
5-chloro-N-(4,4-difluorobutan-2-yl)pyridin-2-amine (PubChem CID 130639953) has the molecular formula C9H11ClF2N2 and a molecular weight of 220.65 g/mol. Its IUPAC name is 5-chloro-N-(4,4-difluorobutan-2-yl)pyridin-2-amine.
| Compound Name | 5-chloro-N-(4,4-difluorobutan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 130639953 |
| Molecular Formula | C9H11ClF2N2 |
| Molecular Weight | 220.65 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 5-chloro-N-(4,4-difluorobutan-2-yl)pyridin-2-amine |
| SMILES | CC(CC(F)F)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C9H11ClF2N2/c1-6(4-8(11)12)14-9-3-2-7(10)5-13-9/h2-3,5-6,8H,4H2,1H3,(H,13,14) |
| InChIKey | QRXWBKXBIIWAFF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.65 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |