C6H7ClN2O6P2+2 — CID 71214104
[[(5-chloro-2-pyridinyl)amino]-[hydroxy(oxo)phosphaniumyl]oxymethoxy]-hydroxy-oxophosphanium (PubChem CID 71214104) has the molecular formula C6H7ClN2O6P2+2 and a molecular weight of 300.53 g/mol. Its IUPAC name is [[(5-chloro-2-pyridinyl)amino]-[hydroxy(oxo)phosphaniumyl]oxymethoxy]-hydroxy-oxophosphanium.
| Compound Name | [[(5-chloro-2-pyridinyl)amino]-[hydroxy(oxo)phosphaniumyl]oxymethoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 71214104 |
| Molecular Formula | C6H7ClN2O6P2+2 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 299.95 |
| IUPAC Name | [[(5-chloro-2-pyridinyl)amino]-[hydroxy(oxo)phosphaniumyl]oxymethoxy]-hydroxy-oxophosphanium |
| SMILES | O=[P+](O)OC(Nc1ccc(Cl)cn1)O[P+](=O)O |
| InChI | InChI=1S/C6H5ClN2O6P2/c7-4-1-2-5(8-3-4)9-6(14-16(10)11)15-17(12)13/h1-3,6H,(H-2,8,9,10,11,12,13)/p+2 |
| InChIKey | MCMQIULWPCXAAW-UHFFFAOYSA-P |
| XLogP | 1.76 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|