C10H13N5S — CID 80897852
6-hydrazinyl-N-(2-thiophen-3-ylethyl)pyrimidin-4-amine (PubChem CID 80897852) has the molecular formula C10H13N5S and a molecular weight of 235.32 g/mol. Its IUPAC name is 6-hydrazinyl-N-(2-thiophen-3-ylethyl)pyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N-(2-thiophen-3-ylethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80897852 |
| Molecular Formula | C10H13N5S |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 6-hydrazinyl-N-(2-thiophen-3-ylethyl)pyrimidin-4-amine |
| SMILES | NNc1cc(NCCc2ccsc2)ncn1 |
| InChI | InChI=1S/C10H13N5S/c11-15-10-5-9(13-7-14-10)12-3-1-8-2-4-16-6-8/h2,4-7H,1,3,11H2,(H2,12,13,14,15) |
| InChIKey | ZYQLUKWDPYPBBH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|