C12H15N5S — CID 80896481
N-cyclopropyl-6-hydrazinyl-N-(thiophen-3-ylmethyl)pyrimidin-4-amine (PubChem CID 80896481) has the molecular formula C12H15N5S and a molecular weight of 261.35 g/mol. Its IUPAC name is N-cyclopropyl-6-hydrazinyl-N-(thiophen-3-ylmethyl)pyrimidin-4-amine.
| Compound Name | N-cyclopropyl-6-hydrazinyl-N-(thiophen-3-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80896481 |
| Molecular Formula | C12H15N5S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | N-cyclopropyl-6-hydrazinyl-N-(thiophen-3-ylmethyl)pyrimidin-4-amine |
| SMILES | NNc1cc(N(Cc2ccsc2)C2CC2)ncn1 |
| InChI | InChI=1S/C12H15N5S/c13-16-11-5-12(15-8-14-11)17(10-1-2-10)6-9-3-4-18-7-9/h3-5,7-8,10H,1-2,6,13H2,(H,14,15,16) |
| InChIKey | FHPLRMWGMJTJHZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|