C11H13N3S2 — CID 106972720
6-methylsulfanyl-N-(2-thiophen-3-ylethyl)pyrimidin-4-amine (PubChem CID 106972720) has the molecular formula C11H13N3S2 and a molecular weight of 251.38 g/mol. Its IUPAC name is 6-methylsulfanyl-N-(2-thiophen-3-ylethyl)pyrimidin-4-amine.
| Compound Name | 6-methylsulfanyl-N-(2-thiophen-3-ylethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106972720 |
| Molecular Formula | C11H13N3S2 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 6-methylsulfanyl-N-(2-thiophen-3-ylethyl)pyrimidin-4-amine |
| SMILES | CSc1cc(NCCc2ccsc2)ncn1 |
| InChI | InChI=1S/C11H13N3S2/c1-15-11-6-10(13-8-14-11)12-4-2-9-3-5-16-7-9/h3,5-8H,2,4H2,1H3,(H,12,13,14) |
| InChIKey | HVHXEEAGCVMWPL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |