C11H11BrN2S — CID 63962803
6-bromo-N-(2-thiophen-3-ylethyl)pyridin-2-amine (PubChem CID 63962803) has the molecular formula C11H11BrN2S and a molecular weight of 283.19 g/mol. Its IUPAC name is 6-bromo-N-(2-thiophen-3-ylethyl)pyridin-2-amine.
| Compound Name | 6-bromo-N-(2-thiophen-3-ylethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 63962803 |
| Molecular Formula | C11H11BrN2S |
| Molecular Weight | 283.19 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | 6-bromo-N-(2-thiophen-3-ylethyl)pyridin-2-amine |
| SMILES | Brc1cccc(NCCc2ccsc2)n1 |
| InChI | InChI=1S/C11H11BrN2S/c12-10-2-1-3-11(14-10)13-6-4-9-5-7-15-8-9/h1-3,5,7-8H,4,6H2,(H,13,14) |
| InChIKey | USRAAXBEBQARLM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.19 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|