C7H9N5S — CID 164652701
N-(2-thiophen-3-ylethyl)-2H-tetrazol-5-amine (PubChem CID 164652701) has the molecular formula C7H9N5S and a molecular weight of 195.25 g/mol. Its IUPAC name is N-(2-thiophen-3-ylethyl)-2H-tetrazol-5-amine.
| Compound Name | N-(2-thiophen-3-ylethyl)-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 164652701 |
| Molecular Formula | C7H9N5S |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | N-(2-thiophen-3-ylethyl)-2H-tetrazol-5-amine |
| SMILES | c1cc(CCNc2nn[nH]n2)cs1 |
| InChI | InChI=1S/C7H9N5S/c1(6-2-4-13-5-6)3-8-7-9-11-12-10-7/h2,4-5H,1,3H2,(H2,8,9,10,11,12) |
| InChIKey | IWYDHNHGKYMKJI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |