C12H13N3O2S — CID 107553518
6-methyl-2-(2-thiophen-3-ylethylamino)pyrimidine-4-carboxylic acid (PubChem CID 107553518) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is 6-methyl-2-(2-thiophen-3-ylethylamino)pyrimidine-4-carboxylic acid.
| Compound Name | 6-methyl-2-(2-thiophen-3-ylethylamino)pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 107553518 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 6-methyl-2-(2-thiophen-3-ylethylamino)pyrimidine-4-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)nc(NCCc2ccsc2)n1 |
| InChI | InChI=1S/C12H13N3O2S/c1-8-6-10(11(16)17)15-12(14-8)13-4-2-9-3-5-18-7-9/h3,5-7H,2,4H2,1H3,(H,16,17)(H,13,14,15) |
| InChIKey | NISOMGJCNJWGIW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |