C13H14ClNS — CID 65025347
4-(chloromethyl)-N-(2-thiophen-3-ylethyl)aniline (PubChem CID 65025347) has the molecular formula C13H14ClNS and a molecular weight of 251.78 g/mol. Its IUPAC name is 4-(chloromethyl)-N-(2-thiophen-3-ylethyl)aniline.
| Compound Name | 4-(chloromethyl)-N-(2-thiophen-3-ylethyl)aniline |
|---|---|
| PubChem CID | 65025347 |
| Molecular Formula | C13H14ClNS |
| Molecular Weight | 251.78 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 4-(chloromethyl)-N-(2-thiophen-3-ylethyl)aniline |
| SMILES | ClCc1ccc(NCCc2ccsc2)cc1 |
| InChI | InChI=1S/C13H14ClNS/c14-9-11-1-3-13(4-2-11)15-7-5-12-6-8-16-10-12/h1-4,6,8,10,15H,5,7,9H2 |
| InChIKey | HPPQABXBICZTEX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.78 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|