C19H24N2O2S — CID 154873730
N-[(1S,2S)-2-hydroxycyclohexyl]-4-(2-thiophen-3-ylethylamino)benzamide (PubChem CID 154873730) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxycyclohexyl]-4-(2-thiophen-3-ylethylamino)benzamide.
| Compound Name | N-[(1S,2S)-2-hydroxycyclohexyl]-4-(2-thiophen-3-ylethylamino)benzamide |
|---|---|
| PubChem CID | 154873730 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | N-[(1S,2S)-2-hydroxycyclohexyl]-4-(2-thiophen-3-ylethylamino)benzamide |
| SMILES | O=C(N[C@H]1CCCC[C@@H]1O)c1ccc(NCCc2ccsc2)cc1 |
| InChI | InChI=1S/C19H24N2O2S/c22-18-4-2-1-3-17(18)21-19(23)15-5-7-16(8-6-15)20-11-9-14-10-12-24-13-14/h5-8,10,12-13,17-18,20,22H,1-4,9,11H2,(H,21,23)/t17-,18-/m0/s1 |
| InChIKey | CYDJFQQVHOHKEW-ROUUACIJSA-N |
| XLogP | 3.44 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |