C12H23N5 — CID 80903091
6-hydrazinyl-N-(2,4,4-trimethylpentan-2-yl)pyrimidin-4-amine (PubChem CID 80903091) has the molecular formula C12H23N5 and a molecular weight of 237.35 g/mol. Its IUPAC name is 6-hydrazinyl-N-(2,4,4-trimethylpentan-2-yl)pyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N-(2,4,4-trimethylpentan-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80903091 |
| Molecular Formula | C12H23N5 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.20 |
| IUPAC Name | 6-hydrazinyl-N-(2,4,4-trimethylpentan-2-yl)pyrimidin-4-amine |
| SMILES | CC(C)(C)CC(C)(C)Nc1cc(NN)ncn1 |
| InChI | InChI=1S/C12H23N5/c1-11(2,3)7-12(4,5)16-9-6-10(17-13)15-8-14-9/h6,8H,7,13H2,1-5H3,(H2,14,15,16,17) |
| InChIKey | FRGXJUJZVDNAEK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|