C12H22N4 — CID 80811854
4-N-(2,4,4-trimethylpentan-2-yl)pyrimidine-4,6-diamine (PubChem CID 80811854) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 4-N-(2,4,4-trimethylpentan-2-yl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(2,4,4-trimethylpentan-2-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80811854 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 4-N-(2,4,4-trimethylpentan-2-yl)pyrimidine-4,6-diamine |
| SMILES | CC(C)(C)CC(C)(C)Nc1cc(N)ncn1 |
| InChI | InChI=1S/C12H22N4/c1-11(2,3)7-12(4,5)16-10-6-9(13)14-8-15-10/h6,8H,7H2,1-5H3,(H3,13,14,15,16) |
| InChIKey | SFSZCJSBWVIFND-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |