C10H12F3N7 — CID 106775475
6-hydrazinyl-N-(2-imidazol-1-ylethyl)-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106775475) has the molecular formula C10H12F3N7 and a molecular weight of 287.25 g/mol. Its IUPAC name is 6-hydrazinyl-N-(2-imidazol-1-ylethyl)-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N-(2-imidazol-1-ylethyl)-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106775475 |
| Molecular Formula | C10H12F3N7 |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 6-hydrazinyl-N-(2-imidazol-1-ylethyl)-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | NNc1cc(NCCn2ccnc2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H12F3N7/c11-10(12,13)9-17-7(5-8(18-9)19-14)16-2-4-20-3-1-15-6-20/h1,3,5-6H,2,4,14H2,(H2,16,17,18,19) |
| InChIKey | GBGRYFMRUXRHFW-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|