C10H16N8S — CID 80897667
6-hydrazinyl-4-N,4-N-dimethyl-2-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3,5-triazine-2,4-diamine (PubChem CID 80897667) has the molecular formula C10H16N8S and a molecular weight of 280.36 g/mol. Its IUPAC name is 6-hydrazinyl-4-N,4-N-dimethyl-2-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-hydrazinyl-4-N,4-N-dimethyl-2-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80897667 |
| Molecular Formula | C10H16N8S |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 6-hydrazinyl-4-N,4-N-dimethyl-2-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1csc(CNc2nc(NN)nc(N(C)C)n2)n1 |
| InChI | InChI=1S/C10H16N8S/c1-6-5-19-7(13-6)4-12-8-14-9(17-11)16-10(15-8)18(2)3/h5H,4,11H2,1-3H3,(H2,12,14,15,16,17) |
| InChIKey | QYKCUHAIVUIHOD-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 104.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|