C11H19N9 — CID 106043401
2-N-[(1,5-dimethylpyrazol-4-yl)methyl]-6-hydrazinyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 106043401) has the molecular formula C11H19N9 and a molecular weight of 277.34 g/mol. Its IUPAC name is 2-N-[(1,5-dimethylpyrazol-4-yl)methyl]-6-hydrazinyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(1,5-dimethylpyrazol-4-yl)methyl]-6-hydrazinyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 106043401 |
| Molecular Formula | C11H19N9 |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 2-N-[(1,5-dimethylpyrazol-4-yl)methyl]-6-hydrazinyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1c(CNc2nc(NN)nc(N(C)C)n2)cnn1C |
| InChI | InChI=1S/C11H19N9/c1-7-8(6-14-20(7)4)5-13-9-15-10(18-12)17-11(16-9)19(2)3/h6H,5,12H2,1-4H3,(H2,13,15,16,17,18) |
| InChIKey | IBPJVNIMLJLUQQ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 109.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|