C13H20N6S — CID 80854992
4-N-[(3-ethylthiophen-2-yl)methyl]-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80854992) has the molecular formula C13H20N6S and a molecular weight of 292.41 g/mol. Its IUPAC name is 4-N-[(3-ethylthiophen-2-yl)methyl]-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-[(3-ethylthiophen-2-yl)methyl]-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80854992 |
| Molecular Formula | C13H20N6S |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 4-N-[(3-ethylthiophen-2-yl)methyl]-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCc1ccsc1CNc1nc(NC)nc(N(C)C)n1 |
| InChI | InChI=1S/C13H20N6S/c1-5-9-6-7-20-10(9)8-15-12-16-11(14-2)17-13(18-12)19(3)4/h6-7H,5,8H2,1-4H3,(H2,14,15,16,17,18) |
| InChIKey | NQTYAIYJIJBOQD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |