C13H19N7 — CID 80821942
2-N,2-N,6-N-trimethyl-4-N-[(6-methyl-2-pyridinyl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 80821942) has the molecular formula C13H19N7 and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-N,2-N,6-N-trimethyl-4-N-[(6-methyl-2-pyridinyl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,6-N-trimethyl-4-N-[(6-methyl-2-pyridinyl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80821942 |
| Molecular Formula | C13H19N7 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 2-N,2-N,6-N-trimethyl-4-N-[(6-methyl-2-pyridinyl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(NCc2cccc(C)n2)nc(N(C)C)n1 |
| InChI | InChI=1S/C13H19N7/c1-9-6-5-7-10(16-9)8-15-12-17-11(14-2)18-13(19-12)20(3)4/h5-7H,8H2,1-4H3,(H2,14,15,17,18,19) |
| InChIKey | ZWYRVAJFAWNOPX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 78.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |