C10H16N8O — CID 106411601
2-N,2-N,6-N-trimethyl-4-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 106411601) has the molecular formula C10H16N8O and a molecular weight of 264.29 g/mol. Its IUPAC name is 2-N,2-N,6-N-trimethyl-4-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,6-N-trimethyl-4-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 106411601 |
| Molecular Formula | C10H16N8O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-N,2-N,6-N-trimethyl-4-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(NCc2noc(C)n2)nc(N(C)C)n1 |
| InChI | InChI=1S/C10H16N8O/c1-6-13-7(17-19-6)5-12-9-14-8(11-2)15-10(16-9)18(3)4/h5H2,1-4H3,(H2,11,12,14,15,16) |
| InChIKey | BKKXAWBCAPNDDV-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |