C26H53N7 — CID 146641463
6-N-(2-amino-2,6,6-trimethylheptan-4-yl)-2-N,2-N,4-N-tributyl-4-N-methyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 146641463) has the molecular formula C26H53N7 and a molecular weight of 463.76 g/mol. Its IUPAC name is 6-N-(2-amino-2,6,6-trimethylheptan-4-yl)-2-N,2-N,4-N-tributyl-4-N-methyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-(2-amino-2,6,6-trimethylheptan-4-yl)-2-N,2-N,4-N-tributyl-4-N-methyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 146641463 |
| Molecular Formula | C26H53N7 |
| Molecular Weight | 463.76 g/mol |
| Exact Mass | 463.44 |
| IUPAC Name | 6-N-(2-amino-2,6,6-trimethylheptan-4-yl)-2-N,2-N,4-N-tributyl-4-N-methyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCN(C)c1nc(NC(CC(C)(C)C)CC(C)(C)N)nc(N(CCCC)CCCC)n1 |
| InChI | InChI=1S/C26H53N7/c1-10-13-16-32(9)23-29-22(28-21(19-25(4,5)6)20-26(7,8)27)30-24(31-23)33(17-14-11-2)18-15-12-3/h21H,10-20,27H2,1-9H3,(H,28,29,30,31) |
| InChIKey | BTLYGCMKESNVPL-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.76 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |