C11H19N9S — CID 80930075
4-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N,N-diethyl-6-hydrazinyl-1,3,5-triazin-2-amine (PubChem CID 80930075) has the molecular formula C11H19N9S and a molecular weight of 309.40 g/mol. Its IUPAC name is 4-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N,N-diethyl-6-hydrazinyl-1,3,5-triazin-2-amine.
| Compound Name | 4-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N,N-diethyl-6-hydrazinyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80930075 |
| Molecular Formula | C11H19N9S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 4-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N,N-diethyl-6-hydrazinyl-1,3,5-triazin-2-amine |
| SMILES | CCN(CC)c1nc(NN)nc(Sc2nnc(C)n2C)n1 |
| InChI | InChI=1S/C11H19N9S/c1-5-20(6-2)9-13-8(16-12)14-10(15-9)21-11-18-17-7(3)19(11)4/h5-6,12H2,1-4H3,(H,13,14,15,16) |
| InChIKey | DCUBVTRHAQQFLW-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|