C12H20N8S — CID 80888160
6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-N,2-N-dimethyl-4-N-propyl-1,3,5-triazine-2,4-diamine (PubChem CID 80888160) has the molecular formula C12H20N8S and a molecular weight of 308.42 g/mol. Its IUPAC name is 6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-N,2-N-dimethyl-4-N-propyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-N,2-N-dimethyl-4-N-propyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80888160 |
| Molecular Formula | C12H20N8S |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-N,2-N-dimethyl-4-N-propyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCNc1nc(Sc2nnc(C)n2C)nc(N(C)C)n1 |
| InChI | InChI=1S/C12H20N8S/c1-6-7-13-9-14-10(19(3)4)16-11(15-9)21-12-18-17-8(2)20(12)5/h6-7H2,1-5H3,(H,13,14,15,16) |
| InChIKey | XWCKTFSUZDFTTD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |