C11H13N9S — CID 80906593
4-hydrazinyl-6-imidazol-1-yl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1,3,5-triazin-2-amine (PubChem CID 80906593) has the molecular formula C11H13N9S and a molecular weight of 303.36 g/mol. Its IUPAC name is 4-hydrazinyl-6-imidazol-1-yl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-6-imidazol-1-yl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80906593 |
| Molecular Formula | C11H13N9S |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 4-hydrazinyl-6-imidazol-1-yl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1,3,5-triazin-2-amine |
| SMILES | Cc1ncsc1CNc1nc(NN)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C11H13N9S/c1-7-8(21-6-15-7)4-14-9-16-10(19-12)18-11(17-9)20-3-2-13-5-20/h2-3,5-6H,4,12H2,1H3,(H2,14,16,17,18,19) |
| InChIKey | UZPXJDXSQCRREP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 119.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|